C11H16FNO4S — CID 54941944
3-fluoro-N-(2-hydroxy-3-methoxypropyl)-N-methylbenzenesulfonamide (PubChem CID 54941944) has the molecular formula C11H16FNO4S and a molecular weight of 277.32 g/mol. Its IUPAC name is 3-fluoro-N-(2-hydroxy-3-methoxypropyl)-N-methylbenzenesulfonamide.
| Compound Name | 3-fluoro-N-(2-hydroxy-3-methoxypropyl)-N-methylbenzenesulfonamide |
|---|---|
| PubChem CID | 54941944 |
| Molecular Formula | C11H16FNO4S |
| Molecular Weight | 277.32 g/mol |
| Exact Mass | 277.08 |
| IUPAC Name | 3-fluoro-N-(2-hydroxy-3-methoxypropyl)-N-methylbenzenesulfonamide |
| SMILES | COCC(O)CN(C)S(=O)(=O)c1cccc(F)c1 |
| InChI | InChI=1S/C11H16FNO4S/c1-13(7-10(14)8-17-2)18(15,16)11-5-3-4-9(12)6-11/h3-6,10,14H,7-8H2,1-2H3 |
| InChIKey | GNBCZFJRRDNLPI-UHFFFAOYSA-N |
| XLogP | 0.45 |
| TPSA | 66.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 277.32 |
| LogP ≤ 5 | 0.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |