C13H20Cl2N2O2S — CID 826892
5,6-dichloro-N,N-bis(2-methylpropyl)pyridine-3-sulfonamide (PubChem CID 826892) has the molecular formula C13H20Cl2N2O2S and a molecular weight of 339.29 g/mol. Its IUPAC name is 5,6-dichloro-N,N-bis(2-methylpropyl)pyridine-3-sulfonamide.
| Compound Name | 5,6-dichloro-N,N-bis(2-methylpropyl)pyridine-3-sulfonamide |
|---|---|
| PubChem CID | 826892 |
| Molecular Formula | C13H20Cl2N2O2S |
| Molecular Weight | 339.29 g/mol |
| Exact Mass | 338.06 |
| IUPAC Name | 5,6-dichloro-N,N-bis(2-methylpropyl)pyridine-3-sulfonamide |
| SMILES | CC(C)CN(CC(C)C)S(=O)(=O)c1cnc(Cl)c(Cl)c1 |
| InChI | InChI=1S/C13H20Cl2N2O2S/c1-9(2)7-17(8-10(3)4)20(18,19)11-5-12(14)13(15)16-6-11/h5-6,9-10H,7-8H2,1-4H3 |
| InChIKey | JRIVOIZMJTXWRY-UHFFFAOYSA-N |
| XLogP | 3.69 |
| TPSA | 50.27 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 339.29 |
| LogP ≤ 5 | 3.69 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|