C6H6Cl2N2OS — CID 167723258
(5,6-dichloro-3-pyridinyl)-imino-methyl-oxo-λ6-sulfane (PubChem CID 167723258) has the molecular formula C6H6Cl2N2OS and a molecular weight of 225.10 g/mol. Its IUPAC name is (5,6-dichloro-3-pyridinyl)-imino-methyl-oxo-λ6-sulfane.
| Compound Name | (5,6-dichloro-3-pyridinyl)-imino-methyl-oxo-λ6-sulfane |
|---|---|
| PubChem CID | 167723258 |
| Molecular Formula | C6H6Cl2N2OS |
| Molecular Weight | 225.10 g/mol |
| Exact Mass | 223.96 |
| IUPAC Name | (5,6-dichloro-3-pyridinyl)-imino-methyl-oxo-λ6-sulfane |
| SMILES | [H]N=S(C)(=O)c1cnc(Cl)c(Cl)c1 |
| InChI | InChI=1S/C6H6Cl2N2OS/c1-12(9,11)4-2-5(7)6(8)10-3-4/h2-3,9H,1H3 |
| InChIKey | NKISZCPBAPCQRL-UHFFFAOYSA-N |
| XLogP | 2.42 |
| TPSA | 53.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 225.10 |
| LogP ≤ 5 | 2.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|