C12H18Cl2N2O2S — CID 64608400
5,6-dichloro-N-(3,3-dimethylbutan-2-yl)-N-methylpyridine-3-sulfonamide (PubChem CID 64608400) has the molecular formula C12H18Cl2N2O2S and a molecular weight of 325.26 g/mol. Its IUPAC name is 5,6-dichloro-N-(3,3-dimethylbutan-2-yl)-N-methylpyridine-3-sulfonamide.
| Compound Name | 5,6-dichloro-N-(3,3-dimethylbutan-2-yl)-N-methylpyridine-3-sulfonamide |
|---|---|
| PubChem CID | 64608400 |
| Molecular Formula | C12H18Cl2N2O2S |
| Molecular Weight | 325.26 g/mol |
| Exact Mass | 324.05 |
| IUPAC Name | 5,6-dichloro-N-(3,3-dimethylbutan-2-yl)-N-methylpyridine-3-sulfonamide |
| SMILES | CC(N(C)S(=O)(=O)c1cnc(Cl)c(Cl)c1)C(C)(C)C |
| InChI | InChI=1S/C12H18Cl2N2O2S/c1-8(12(2,3)4)16(5)19(17,18)9-6-10(13)11(14)15-7-9/h6-8H,1-5H3 |
| InChIKey | GCAKJZUETYZLJI-UHFFFAOYSA-N |
| XLogP | 3.44 |
| TPSA | 50.27 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 325.26 |
| LogP ≤ 5 | 3.44 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|