C13H20ClFN2O2S — CID 61113694
5-amino-2-chloro-N-(3,3-dimethylbutan-2-yl)-4-fluoro-N-methylbenzenesulfonamide (PubChem CID 61113694) has the molecular formula C13H20ClFN2O2S and a molecular weight of 322.83 g/mol. Its IUPAC name is 5-amino-2-chloro-N-(3,3-dimethylbutan-2-yl)-4-fluoro-N-methylbenzenesulfonamide.
| Compound Name | 5-amino-2-chloro-N-(3,3-dimethylbutan-2-yl)-4-fluoro-N-methylbenzenesulfonamide |
|---|---|
| PubChem CID | 61113694 |
| Molecular Formula | C13H20ClFN2O2S |
| Molecular Weight | 322.83 g/mol |
| Exact Mass | 322.09 |
| IUPAC Name | 5-amino-2-chloro-N-(3,3-dimethylbutan-2-yl)-4-fluoro-N-methylbenzenesulfonamide |
| SMILES | CC(N(C)S(=O)(=O)c1cc(N)c(F)cc1Cl)C(C)(C)C |
| InChI | InChI=1S/C13H20ClFN2O2S/c1-8(13(2,3)4)17(5)20(18,19)12-7-11(16)10(15)6-9(12)14/h6-8H,16H2,1-5H3 |
| InChIKey | RAHDNKZKSXZOMK-UHFFFAOYSA-N |
| XLogP | 3.12 |
| TPSA | 63.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 322.83 |
| LogP ≤ 5 | 3.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|