C15H25FN2O2S — CID 107325691
3-amino-N-(3,3-dimethylbutan-2-yl)-4-fluoro-N,2,6-trimethylbenzenesulfonamide (PubChem CID 107325691) has the molecular formula C15H25FN2O2S and a molecular weight of 316.44 g/mol. Its IUPAC name is 3-amino-N-(3,3-dimethylbutan-2-yl)-4-fluoro-N,2,6-trimethylbenzenesulfonamide.
| Compound Name | 3-amino-N-(3,3-dimethylbutan-2-yl)-4-fluoro-N,2,6-trimethylbenzenesulfonamide |
|---|---|
| PubChem CID | 107325691 |
| Molecular Formula | C15H25FN2O2S |
| Molecular Weight | 316.44 g/mol |
| Exact Mass | 316.16 |
| IUPAC Name | 3-amino-N-(3,3-dimethylbutan-2-yl)-4-fluoro-N,2,6-trimethylbenzenesulfonamide |
| SMILES | Cc1cc(F)c(N)c(C)c1S(=O)(=O)N(C)C(C)C(C)(C)C |
| InChI | InChI=1S/C15H25FN2O2S/c1-9-8-12(16)13(17)10(2)14(9)21(19,20)18(7)11(3)15(4,5)6/h8,11H,17H2,1-7H3 |
| InChIKey | HCAMPCYBCATDTR-UHFFFAOYSA-N |
| XLogP | 3.08 |
| TPSA | 63.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 316.44 |
| LogP ≤ 5 | 3.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|