C17H19Cl2N3O3S — CID 7733390
N-[4-[butyl(methyl)sulfamoyl]phenyl]-5,6-dichloropyridine-3-carboxamide (PubChem CID 7733390) has the molecular formula C17H19Cl2N3O3S and a molecular weight of 416.33 g/mol. Its IUPAC name is N-[4-[butyl(methyl)sulfamoyl]phenyl]-5,6-dichloropyridine-3-carboxamide.
| Compound Name | N-[4-[butyl(methyl)sulfamoyl]phenyl]-5,6-dichloropyridine-3-carboxamide |
|---|---|
| PubChem CID | 7733390 |
| Molecular Formula | C17H19Cl2N3O3S |
| Molecular Weight | 416.33 g/mol |
| Exact Mass | 415.05 |
| IUPAC Name | N-[4-[butyl(methyl)sulfamoyl]phenyl]-5,6-dichloropyridine-3-carboxamide |
| SMILES | CCCCN(C)S(=O)(=O)c1ccc(NC(=O)c2cnc(Cl)c(Cl)c2)cc1 |
| InChI | InChI=1S/C17H19Cl2N3O3S/c1-3-4-9-22(2)26(24,25)14-7-5-13(6-8-14)21-17(23)12-10-15(18)16(19)20-11-12/h5-8,10-11H,3-4,9H2,1-2H3,(H,21,23) |
| InChIKey | PBDFPESBYZNHNT-UHFFFAOYSA-N |
| XLogP | 4.06 |
| TPSA | 79.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 416.33 |
| LogP ≤ 5 | 4.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|