C13H17Br2NO3S — CID 47350790
2,5-dibromo-N-ethyl-N-(oxolan-3-ylmethyl)benzenesulfonamide (PubChem CID 47350790) has the molecular formula C13H17Br2NO3S and a molecular weight of 427.16 g/mol. Its IUPAC name is 2,5-dibromo-N-ethyl-N-(oxolan-3-ylmethyl)benzenesulfonamide.
| Compound Name | 2,5-dibromo-N-ethyl-N-(oxolan-3-ylmethyl)benzenesulfonamide |
|---|---|
| PubChem CID | 47350790 |
| Molecular Formula | C13H17Br2NO3S |
| Molecular Weight | 427.16 g/mol |
| Exact Mass | 424.93 |
| IUPAC Name | 2,5-dibromo-N-ethyl-N-(oxolan-3-ylmethyl)benzenesulfonamide |
| SMILES | CCN(CC1CCOC1)S(=O)(=O)c1cc(Br)ccc1Br |
| InChI | InChI=1S/C13H17Br2NO3S/c1-2-16(8-10-5-6-19-9-10)20(17,18)13-7-11(14)3-4-12(13)15/h3-4,7,10H,2,5-6,8-9H2,1H3 |
| InChIKey | KFVVEGALBYEYPP-UHFFFAOYSA-N |
| XLogP | 3.26 |
| TPSA | 46.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 427.16 |
| LogP ≤ 5 | 3.26 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |