C22H20ClN3O4S — CID 69028522
5-chloro-1-(1-quinolin-6-ylsulfonylpiperidin-4-yl)-4H-3,1-benzoxazin-2-one (PubChem CID 69028522) has the molecular formula C22H20ClN3O4S and a molecular weight of 457.94 g/mol. Its IUPAC name is 5-chloro-1-(1-quinolin-6-ylsulfonylpiperidin-4-yl)-4H-3,1-benzoxazin-2-one.
| Compound Name | 5-chloro-1-(1-quinolin-6-ylsulfonylpiperidin-4-yl)-4H-3,1-benzoxazin-2-one |
|---|---|
| PubChem CID | 69028522 |
| Molecular Formula | C22H20ClN3O4S |
| Molecular Weight | 457.94 g/mol |
| Exact Mass | 457.09 |
| IUPAC Name | 5-chloro-1-(1-quinolin-6-ylsulfonylpiperidin-4-yl)-4H-3,1-benzoxazin-2-one |
| SMILES | O=C1OCc2c(Cl)cccc2N1C1CCN(S(=O)(=O)c2ccc3ncccc3c2)CC1 |
| InChI | InChI=1S/C22H20ClN3O4S/c23-19-4-1-5-21-18(19)14-30-22(27)26(21)16-8-11-25(12-9-16)31(28,29)17-6-7-20-15(13-17)3-2-10-24-20/h1-7,10,13,16H,8-9,11-12,14H2 |
| InChIKey | RFWBLZXAURVOSB-UHFFFAOYSA-N |
| XLogP | 4.20 |
| TPSA | 79.81 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 457.94 |
| LogP ≤ 5 | 4.20 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |