C19H19FN2O4S — CID 58792794
1-[1-(3-fluorophenyl)sulfonylpiperidin-4-yl]-4H-3,1-benzoxazin-2-one (PubChem CID 58792794) has the molecular formula C19H19FN2O4S and a molecular weight of 390.44 g/mol. Its IUPAC name is 1-[1-(3-fluorophenyl)sulfonylpiperidin-4-yl]-4H-3,1-benzoxazin-2-one.
| Compound Name | 1-[1-(3-fluorophenyl)sulfonylpiperidin-4-yl]-4H-3,1-benzoxazin-2-one |
|---|---|
| PubChem CID | 58792794 |
| Molecular Formula | C19H19FN2O4S |
| Molecular Weight | 390.44 g/mol |
| Exact Mass | 390.10 |
| IUPAC Name | 1-[1-(3-fluorophenyl)sulfonylpiperidin-4-yl]-4H-3,1-benzoxazin-2-one |
| SMILES | O=C1OCc2ccccc2N1C1CCN(S(=O)(=O)c2cccc(F)c2)CC1 |
| InChI | InChI=1S/C19H19FN2O4S/c20-15-5-3-6-17(12-15)27(24,25)21-10-8-16(9-11-21)22-18-7-2-1-4-14(18)13-26-19(22)23/h1-7,12,16H,8-11,13H2 |
| InChIKey | WDKHDIYCYSPHTM-UHFFFAOYSA-N |
| XLogP | 3.14 |
| TPSA | 66.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 390.44 |
| LogP ≤ 5 | 3.14 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |