C17H18N2O4S2 — CID 68531327
1-(1-thiophen-3-ylsulfonylpiperidin-4-yl)-4H-3,1-benzoxazin-2-one (PubChem CID 68531327) has the molecular formula C17H18N2O4S2 and a molecular weight of 378.48 g/mol. Its IUPAC name is 1-(1-thiophen-3-ylsulfonylpiperidin-4-yl)-4H-3,1-benzoxazin-2-one.
| Compound Name | 1-(1-thiophen-3-ylsulfonylpiperidin-4-yl)-4H-3,1-benzoxazin-2-one |
|---|---|
| PubChem CID | 68531327 |
| Molecular Formula | C17H18N2O4S2 |
| Molecular Weight | 378.48 g/mol |
| Exact Mass | 378.07 |
| IUPAC Name | 1-(1-thiophen-3-ylsulfonylpiperidin-4-yl)-4H-3,1-benzoxazin-2-one |
| SMILES | O=C1OCc2ccccc2N1C1CCN(S(=O)(=O)c2ccsc2)CC1 |
| InChI | InChI=1S/C17H18N2O4S2/c20-17-19(16-4-2-1-3-13(16)11-23-17)14-5-8-18(9-6-14)25(21,22)15-7-10-24-12-15/h1-4,7,10,12,14H,5-6,8-9,11H2 |
| InChIKey | DIGGPYNYTFGYQA-UHFFFAOYSA-N |
| XLogP | 3.06 |
| TPSA | 66.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 378.48 |
| LogP ≤ 5 | 3.06 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |