C20H21ClN4O4S2 — CID 68531275
5-chloro-1-[1-[(5-methyl-2H-[1,2,5]thiadiazolo[2,3-a]pyridin-4-yl)sulfonyl]piperidin-4-yl]-4H-3,1-benzoxazin-2-one (PubChem CID 68531275) has the molecular formula C20H21ClN4O4S2 and a molecular weight of 481.00 g/mol. Its IUPAC name is 5-chloro-1-[1-[(5-methyl-2H-[1,2,5]thiadiazolo[2,3-a]pyridin-4-yl)sulfonyl]piperidin-4-yl]-4H-3,1-benzoxazin-2-one.
| Compound Name | 5-chloro-1-[1-[(5-methyl-2H-[1,2,5]thiadiazolo[2,3-a]pyridin-4-yl)sulfonyl]piperidin-4-yl]-4H-3,1-benzoxazin-2-one |
|---|---|
| PubChem CID | 68531275 |
| Molecular Formula | C20H21ClN4O4S2 |
| Molecular Weight | 481.00 g/mol |
| Exact Mass | 480.07 |
| IUPAC Name | 5-chloro-1-[1-[(5-methyl-2H-[1,2,5]thiadiazolo[2,3-a]pyridin-4-yl)sulfonyl]piperidin-4-yl]-4H-3,1-benzoxazin-2-one |
| SMILES | CC1=C(S(=O)(=O)N2CCC(N3C(=O)OCc4c(Cl)cccc43)CC2)C2=CNSN2C=C1 |
| InChI | InChI=1S/C20H21ClN4O4S2/c1-13-5-10-24-18(11-22-30-24)19(13)31(27,28)23-8-6-14(7-9-23)25-17-4-2-3-16(21)15(17)12-29-20(25)26/h2-5,10-11,14,22H,6-9,12H2,1H3 |
| InChIKey | VXLSUDFYUSUQHL-UHFFFAOYSA-N |
| XLogP | 3.70 |
| TPSA | 82.19 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 481.00 |
| LogP ≤ 5 | 3.70 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|