C15H19N3O2S — CID 79179415
6-(3,4-dimethylpyrrolidin-1-yl)sulfonylquinolin-2-amine (PubChem CID 79179415) has the molecular formula C15H19N3O2S and a molecular weight of 305.40 g/mol. Its IUPAC name is 6-(3,4-dimethylpyrrolidin-1-yl)sulfonylquinolin-2-amine.
| Compound Name | 6-(3,4-dimethylpyrrolidin-1-yl)sulfonylquinolin-2-amine |
|---|---|
| PubChem CID | 79179415 |
| Molecular Formula | C15H19N3O2S |
| Molecular Weight | 305.40 g/mol |
| Exact Mass | 305.12 |
| IUPAC Name | 6-(3,4-dimethylpyrrolidin-1-yl)sulfonylquinolin-2-amine |
| SMILES | CC1CN(S(=O)(=O)c2ccc3nc(N)ccc3c2)CC1C |
| InChI | InChI=1S/C15H19N3O2S/c1-10-8-18(9-11(10)2)21(19,20)13-4-5-14-12(7-13)3-6-15(16)17-14/h3-7,10-11H,8-9H2,1-2H3,(H2,16,17) |
| InChIKey | AVTDLJGMPMZVJL-UHFFFAOYSA-N |
| XLogP | 2.09 |
| TPSA | 76.29 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 305.40 |
| LogP ≤ 5 | 2.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |