C14H17N3O3S — CID 103538322
6-(3-methoxypyrrolidin-1-yl)sulfonylquinolin-2-amine (PubChem CID 103538322) has the molecular formula C14H17N3O3S and a molecular weight of 307.38 g/mol. Its IUPAC name is 6-(3-methoxypyrrolidin-1-yl)sulfonylquinolin-2-amine.
| Compound Name | 6-(3-methoxypyrrolidin-1-yl)sulfonylquinolin-2-amine |
|---|---|
| PubChem CID | 103538322 |
| Molecular Formula | C14H17N3O3S |
| Molecular Weight | 307.38 g/mol |
| Exact Mass | 307.10 |
| IUPAC Name | 6-(3-methoxypyrrolidin-1-yl)sulfonylquinolin-2-amine |
| SMILES | COC1CCN(S(=O)(=O)c2ccc3nc(N)ccc3c2)C1 |
| InChI | InChI=1S/C14H17N3O3S/c1-20-11-6-7-17(9-11)21(18,19)12-3-4-13-10(8-12)2-5-14(15)16-13/h2-5,8,11H,6-7,9H2,1H3,(H2,15,16) |
| InChIKey | QDCOFGIKLYTKTP-UHFFFAOYSA-N |
| XLogP | 1.23 |
| TPSA | 85.52 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 307.38 |
| LogP ≤ 5 | 1.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |