C11H15N3O5S — CID 103535330
4-(3-methoxypyrrolidin-1-yl)sulfonyl-2-nitroaniline (PubChem CID 103535330) has the molecular formula C11H15N3O5S and a molecular weight of 301.32 g/mol. Its IUPAC name is 4-(3-methoxypyrrolidin-1-yl)sulfonyl-2-nitroaniline.
| Compound Name | 4-(3-methoxypyrrolidin-1-yl)sulfonyl-2-nitroaniline |
|---|---|
| PubChem CID | 103535330 |
| Molecular Formula | C11H15N3O5S |
| Molecular Weight | 301.32 g/mol |
| Exact Mass | 301.07 |
| IUPAC Name | 4-(3-methoxypyrrolidin-1-yl)sulfonyl-2-nitroaniline |
| SMILES | COC1CCN(S(=O)(=O)c2ccc(N)c([N+](=O)[O-])c2)C1 |
| InChI | InChI=1S/C11H15N3O5S/c1-19-8-4-5-13(7-8)20(17,18)9-2-3-10(12)11(6-9)14(15)16/h2-3,6,8H,4-5,7,12H2,1H3 |
| InChIKey | NUWUWUYHQBMBCD-UHFFFAOYSA-N |
| XLogP | 0.59 |
| TPSA | 115.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 301.32 |
| LogP ≤ 5 | 0.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|