C15H21N3O2S — CID 62152213
2-amino-N-(2,2-dimethylpropyl)-N-methylquinoline-6-sulfonamide (PubChem CID 62152213) has the molecular formula C15H21N3O2S and a molecular weight of 307.42 g/mol. Its IUPAC name is 2-amino-N-(2,2-dimethylpropyl)-N-methylquinoline-6-sulfonamide.
| Compound Name | 2-amino-N-(2,2-dimethylpropyl)-N-methylquinoline-6-sulfonamide |
|---|---|
| PubChem CID | 62152213 |
| Molecular Formula | C15H21N3O2S |
| Molecular Weight | 307.42 g/mol |
| Exact Mass | 307.14 |
| IUPAC Name | 2-amino-N-(2,2-dimethylpropyl)-N-methylquinoline-6-sulfonamide |
| SMILES | CN(CC(C)(C)C)S(=O)(=O)c1ccc2nc(N)ccc2c1 |
| InChI | InChI=1S/C15H21N3O2S/c1-15(2,3)10-18(4)21(19,20)12-6-7-13-11(9-12)5-8-14(16)17-13/h5-9H,10H2,1-4H3,(H2,16,17) |
| InChIKey | LNXWJKJQVUDTOK-UHFFFAOYSA-N |
| XLogP | 2.48 |
| TPSA | 76.29 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 307.42 |
| LogP ≤ 5 | 2.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |