C21H18N4O3S2 — CID 162523062
(3R)-N-(1,3-benzothiazol-5-yl)-1-quinolin-6-ylsulfonylpyrrolidine-3-carboxamide (PubChem CID 162523062) has the molecular formula C21H18N4O3S2 and a molecular weight of 438.53 g/mol. Its IUPAC name is (3R)-N-(1,3-benzothiazol-5-yl)-1-quinolin-6-ylsulfonylpyrrolidine-3-carboxamide.
| Compound Name | (3R)-N-(1,3-benzothiazol-5-yl)-1-quinolin-6-ylsulfonylpyrrolidine-3-carboxamide |
|---|---|
| PubChem CID | 162523062 |
| Molecular Formula | C21H18N4O3S2 |
| Molecular Weight | 438.53 g/mol |
| Exact Mass | 438.08 |
| IUPAC Name | (3R)-N-(1,3-benzothiazol-5-yl)-1-quinolin-6-ylsulfonylpyrrolidine-3-carboxamide |
| SMILES | O=C(Nc1ccc2scnc2c1)[C@@H]1CCN(S(=O)(=O)c2ccc3ncccc3c2)C1 |
| InChI | InChI=1S/C21H18N4O3S2/c26-21(24-16-3-6-20-19(11-16)23-13-29-20)15-7-9-25(12-15)30(27,28)17-4-5-18-14(10-17)2-1-8-22-18/h1-6,8,10-11,13,15H,7,9,12H2,(H,24,26)/t15-/m1/s1 |
| InChIKey | XOPWYQFJXUSXOB-OAHLLOKOSA-N |
| XLogP | 3.49 |
| TPSA | 92.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 438.53 |
| LogP ≤ 5 | 3.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |