C18H23N3O2S — CID 131895532
N-(1,3-benzothiazol-5-yl)-1-(oxan-4-yl)piperidine-3-carboxamide (PubChem CID 131895532) has the molecular formula C18H23N3O2S and a molecular weight of 345.47 g/mol. Its IUPAC name is N-(1,3-benzothiazol-5-yl)-1-(oxan-4-yl)piperidine-3-carboxamide.
| Compound Name | N-(1,3-benzothiazol-5-yl)-1-(oxan-4-yl)piperidine-3-carboxamide |
|---|---|
| PubChem CID | 131895532 |
| Molecular Formula | C18H23N3O2S |
| Molecular Weight | 345.47 g/mol |
| Exact Mass | 345.15 |
| IUPAC Name | N-(1,3-benzothiazol-5-yl)-1-(oxan-4-yl)piperidine-3-carboxamide |
| SMILES | O=C(Nc1ccc2scnc2c1)C1CCCN(C2CCOCC2)C1 |
| InChI | InChI=1S/C18H23N3O2S/c22-18(20-14-3-4-17-16(10-14)19-12-24-17)13-2-1-7-21(11-13)15-5-8-23-9-6-15/h3-4,10,12-13,15H,1-2,5-9,11H2,(H,20,22) |
| InChIKey | XJSWQLQZAMUNAT-UHFFFAOYSA-N |
| XLogP | 3.13 |
| TPSA | 54.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 345.47 |
| LogP ≤ 5 | 3.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |