C17H26N4O2 — CID 97193281
(3S)-N-[(5-methylpyrazin-2-yl)methyl]-1-(oxan-4-yl)piperidine-3-carboxamide (PubChem CID 97193281) has the molecular formula C17H26N4O2 and a molecular weight of 318.42 g/mol. Its IUPAC name is (3S)-N-[(5-methylpyrazin-2-yl)methyl]-1-(oxan-4-yl)piperidine-3-carboxamide.
| Compound Name | (3S)-N-[(5-methylpyrazin-2-yl)methyl]-1-(oxan-4-yl)piperidine-3-carboxamide |
|---|---|
| PubChem CID | 97193281 |
| Molecular Formula | C17H26N4O2 |
| Molecular Weight | 318.42 g/mol |
| Exact Mass | 318.21 |
| IUPAC Name | (3S)-N-[(5-methylpyrazin-2-yl)methyl]-1-(oxan-4-yl)piperidine-3-carboxamide |
| SMILES | Cc1cnc(CNC(=O)[C@H]2CCCN(C3CCOCC3)C2)cn1 |
| InChI | InChI=1S/C17H26N4O2/c1-13-9-19-15(10-18-13)11-20-17(22)14-3-2-6-21(12-14)16-4-7-23-8-5-16/h9-10,14,16H,2-8,11-12H2,1H3,(H,20,22)/t14-/m0/s1 |
| InChIKey | CLIYYBGQSMVWQZ-AWEZNQCLSA-N |
| XLogP | 1.29 |
| TPSA | 67.35 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 318.42 |
| LogP ≤ 5 | 1.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |