C16H26N4O2 — CID 72876993
N-[2-(1H-imidazol-5-yl)ethyl]-1-(oxan-4-yl)piperidine-3-carboxamide (PubChem CID 72876993) has the molecular formula C16H26N4O2 and a molecular weight of 306.41 g/mol. Its IUPAC name is N-[2-(1H-imidazol-5-yl)ethyl]-1-(oxan-4-yl)piperidine-3-carboxamide.
| Compound Name | N-[2-(1H-imidazol-5-yl)ethyl]-1-(oxan-4-yl)piperidine-3-carboxamide |
|---|---|
| PubChem CID | 72876993 |
| Molecular Formula | C16H26N4O2 |
| Molecular Weight | 306.41 g/mol |
| Exact Mass | 306.21 |
| IUPAC Name | N-[2-(1H-imidazol-5-yl)ethyl]-1-(oxan-4-yl)piperidine-3-carboxamide |
| SMILES | O=C(NCCc1cnc[nH]1)C1CCCN(C2CCOCC2)C1 |
| InChI | InChI=1S/C16H26N4O2/c21-16(18-6-3-14-10-17-12-19-14)13-2-1-7-20(11-13)15-4-8-22-9-5-15/h10,12-13,15H,1-9,11H2,(H,17,19)(H,18,21) |
| InChIKey | PVSUKJDJQZILIK-UHFFFAOYSA-N |
| XLogP | 0.96 |
| TPSA | 70.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 306.41 |
| LogP ≤ 5 | 0.96 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |