C22H20F3N3O4S — CID 55784367
N-quinolin-6-yl-1-[3-(trifluoromethoxy)phenyl]sulfonylpiperidine-4-carboxamide (PubChem CID 55784367) has the molecular formula C22H20F3N3O4S and a molecular weight of 479.48 g/mol. Its IUPAC name is N-quinolin-6-yl-1-[3-(trifluoromethoxy)phenyl]sulfonylpiperidine-4-carboxamide.
| Compound Name | N-quinolin-6-yl-1-[3-(trifluoromethoxy)phenyl]sulfonylpiperidine-4-carboxamide |
|---|---|
| PubChem CID | 55784367 |
| Molecular Formula | C22H20F3N3O4S |
| Molecular Weight | 479.48 g/mol |
| Exact Mass | 479.11 |
| IUPAC Name | N-quinolin-6-yl-1-[3-(trifluoromethoxy)phenyl]sulfonylpiperidine-4-carboxamide |
| SMILES | O=C(Nc1ccc2ncccc2c1)C1CCN(S(=O)(=O)c2cccc(OC(F)(F)F)c2)CC1 |
| InChI | InChI=1S/C22H20F3N3O4S/c23-22(24,25)32-18-4-1-5-19(14-18)33(30,31)28-11-8-15(9-12-28)21(29)27-17-6-7-20-16(13-17)3-2-10-26-20/h1-7,10,13-15H,8-9,11-12H2,(H,27,29) |
| InChIKey | FVARSSHKLDUBQF-UHFFFAOYSA-N |
| XLogP | 4.17 |
| TPSA | 88.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 479.48 |
| LogP ≤ 5 | 4.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |