C20H25F3N4O4S — CID 55674493
N-(2-butylpyrazol-3-yl)-1-[3-(trifluoromethoxy)phenyl]sulfonylpiperidine-4-carboxamide (PubChem CID 55674493) has the molecular formula C20H25F3N4O4S and a molecular weight of 474.51 g/mol. Its IUPAC name is N-(2-butylpyrazol-3-yl)-1-[3-(trifluoromethoxy)phenyl]sulfonylpiperidine-4-carboxamide.
| Compound Name | N-(2-butylpyrazol-3-yl)-1-[3-(trifluoromethoxy)phenyl]sulfonylpiperidine-4-carboxamide |
|---|---|
| PubChem CID | 55674493 |
| Molecular Formula | C20H25F3N4O4S |
| Molecular Weight | 474.51 g/mol |
| Exact Mass | 474.15 |
| IUPAC Name | N-(2-butylpyrazol-3-yl)-1-[3-(trifluoromethoxy)phenyl]sulfonylpiperidine-4-carboxamide |
| SMILES | CCCCn1nccc1NC(=O)C1CCN(S(=O)(=O)c2cccc(OC(F)(F)F)c2)CC1 |
| InChI | InChI=1S/C20H25F3N4O4S/c1-2-3-11-27-18(7-10-24-27)25-19(28)15-8-12-26(13-9-15)32(29,30)17-6-4-5-16(14-17)31-20(21,22)23/h4-7,10,14-15H,2-3,8-9,11-13H2,1H3,(H,25,28) |
| InChIKey | RDDGISWQTNVWTJ-UHFFFAOYSA-N |
| XLogP | 3.62 |
| TPSA | 93.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 474.51 |
| LogP ≤ 5 | 3.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |