C17H16N2O2S — CID 171909687
2,4-dimethyl-5-quinolin-6-ylbenzenesulfonamide (PubChem CID 171909687) has the molecular formula C17H16N2O2S and a molecular weight of 312.39 g/mol. Its IUPAC name is 2,4-dimethyl-5-quinolin-6-ylbenzenesulfonamide.
| Compound Name | 2,4-dimethyl-5-quinolin-6-ylbenzenesulfonamide |
|---|---|
| PubChem CID | 171909687 |
| Molecular Formula | C17H16N2O2S |
| Molecular Weight | 312.39 g/mol |
| Exact Mass | 312.09 |
| IUPAC Name | 2,4-dimethyl-5-quinolin-6-ylbenzenesulfonamide |
| SMILES | Cc1cc(C)c(S(N)(=O)=O)cc1-c1ccc2ncccc2c1 |
| InChI | InChI=1S/C17H16N2O2S/c1-11-8-12(2)17(22(18,20)21)10-15(11)13-5-6-16-14(9-13)4-3-7-19-16/h3-10H,1-2H3,(H2,18,20,21) |
| InChIKey | XSWJYUOZHVMDEJ-UHFFFAOYSA-N |
| XLogP | 3.17 |
| TPSA | 73.05 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 312.39 |
| LogP ≤ 5 | 3.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |