C20H16N4 — CID 137430865
3-methyl-6-phenyl-5-quinolin-6-ylpyrazin-2-amine (PubChem CID 137430865) has the molecular formula C20H16N4 and a molecular weight of 312.38 g/mol. Its IUPAC name is 3-methyl-6-phenyl-5-quinolin-6-ylpyrazin-2-amine.
| Compound Name | 3-methyl-6-phenyl-5-quinolin-6-ylpyrazin-2-amine |
|---|---|
| PubChem CID | 137430865 |
| Molecular Formula | C20H16N4 |
| Molecular Weight | 312.38 g/mol |
| Exact Mass | 312.14 |
| IUPAC Name | 3-methyl-6-phenyl-5-quinolin-6-ylpyrazin-2-amine |
| SMILES | Cc1nc(-c2ccc3ncccc3c2)c(-c2ccccc2)nc1N |
| InChI | InChI=1S/C20H16N4/c1-13-20(21)24-18(14-6-3-2-4-7-14)19(23-13)16-9-10-17-15(12-16)8-5-11-22-17/h2-12H,1H3,(H2,21,24) |
| InChIKey | OKNLUCQGECZXKD-UHFFFAOYSA-N |
| XLogP | 4.25 |
| TPSA | 64.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 312.38 |
| LogP ≤ 5 | 4.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |