C26H23N7 — CID 154657983
6-phenyl-3-[(1-pyrazin-2-ylethylamino)methyl]-5-quinolin-6-ylpyrazin-2-amine (PubChem CID 154657983) has the molecular formula C26H23N7 and a molecular weight of 433.52 g/mol. Its IUPAC name is 6-phenyl-3-[(1-pyrazin-2-ylethylamino)methyl]-5-quinolin-6-ylpyrazin-2-amine.
| Compound Name | 6-phenyl-3-[(1-pyrazin-2-ylethylamino)methyl]-5-quinolin-6-ylpyrazin-2-amine |
|---|---|
| PubChem CID | 154657983 |
| Molecular Formula | C26H23N7 |
| Molecular Weight | 433.52 g/mol |
| Exact Mass | 433.20 |
| IUPAC Name | 6-phenyl-3-[(1-pyrazin-2-ylethylamino)methyl]-5-quinolin-6-ylpyrazin-2-amine |
| SMILES | CC(NCc1nc(-c2ccc3ncccc3c2)c(-c2ccccc2)nc1N)c1cnccn1 |
| InChI | InChI=1S/C26H23N7/c1-17(22-15-28-12-13-30-22)31-16-23-26(27)33-24(18-6-3-2-4-7-18)25(32-23)20-9-10-21-19(14-20)8-5-11-29-21/h2-15,17,31H,16H2,1H3,(H2,27,33) |
| InChIKey | NUNLDHTWNWCSQO-UHFFFAOYSA-N |
| XLogP | 4.58 |
| TPSA | 102.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 433.52 |
| LogP ≤ 5 | 4.58 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |