C27H24N6O — CID 154656358
3-amino-N-[(3Z)-3-(methylideneamino)hexa-3,5-dien-2-yl]-5-phenyl-6-quinolin-6-ylpyrazine-2-carboxamide (PubChem CID 154656358) has the molecular formula C27H24N6O and a molecular weight of 448.53 g/mol. Its IUPAC name is 3-amino-N-[(3Z)-3-(methylideneamino)hexa-3,5-dien-2-yl]-5-phenyl-6-quinolin-6-ylpyrazine-2-carboxamide.
| Compound Name | 3-amino-N-[(3Z)-3-(methylideneamino)hexa-3,5-dien-2-yl]-5-phenyl-6-quinolin-6-ylpyrazine-2-carboxamide |
|---|---|
| PubChem CID | 154656358 |
| Molecular Formula | C27H24N6O |
| Molecular Weight | 448.53 g/mol |
| Exact Mass | 448.20 |
| IUPAC Name | 3-amino-N-[(3Z)-3-(methylideneamino)hexa-3,5-dien-2-yl]-5-phenyl-6-quinolin-6-ylpyrazine-2-carboxamide |
| SMILES | C=C/C=C(\N=C)C(C)NC(=O)c1nc(-c2ccc3ncccc3c2)c(-c2ccccc2)nc1N |
| InChI | InChI=1S/C27H24N6O/c1-4-9-21(29-3)17(2)31-27(34)25-26(28)33-23(18-10-6-5-7-11-18)24(32-25)20-13-14-22-19(16-20)12-8-15-30-22/h4-17H,1,3H2,2H3,(H2,28,33)(H,31,34)/b21-9- |
| InChIKey | ADDZCJVQOHRWRN-NKVSQWTQSA-N |
| XLogP | 4.83 |
| TPSA | 106.15 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 448.53 |
| LogP ≤ 5 | 4.83 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|