C25H24N6O — CID 154656204
3-amino-5-phenyl-N-piperidin-3-yl-6-quinolin-6-ylpyrazine-2-carboxamide (PubChem CID 154656204) has the molecular formula C25H24N6O and a molecular weight of 424.51 g/mol. Its IUPAC name is 3-amino-5-phenyl-N-piperidin-3-yl-6-quinolin-6-ylpyrazine-2-carboxamide.
| Compound Name | 3-amino-5-phenyl-N-piperidin-3-yl-6-quinolin-6-ylpyrazine-2-carboxamide |
|---|---|
| PubChem CID | 154656204 |
| Molecular Formula | C25H24N6O |
| Molecular Weight | 424.51 g/mol |
| Exact Mass | 424.20 |
| IUPAC Name | 3-amino-5-phenyl-N-piperidin-3-yl-6-quinolin-6-ylpyrazine-2-carboxamide |
| SMILES | Nc1nc(-c2ccccc2)c(-c2ccc3ncccc3c2)nc1C(=O)NC1CCCNC1 |
| InChI | InChI=1S/C25H24N6O/c26-24-23(25(32)29-19-9-5-12-27-15-19)30-22(21(31-24)16-6-2-1-3-7-16)18-10-11-20-17(14-18)8-4-13-28-20/h1-4,6-8,10-11,13-14,19,27H,5,9,12,15H2,(H2,26,31)(H,29,32) |
| InChIKey | WNBYCRYSNNQJGU-UHFFFAOYSA-N |
| XLogP | 3.42 |
| TPSA | 105.82 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 424.51 |
| LogP ≤ 5 | 3.42 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |