C26H24ClN5O — CID 137430775
3-amino-6-(8-chloroquinolin-6-yl)-N-cyclohexyl-5-phenylpyrazine-2-carboxamide (PubChem CID 137430775) has the molecular formula C26H24ClN5O and a molecular weight of 457.97 g/mol. Its IUPAC name is 3-amino-6-(8-chloroquinolin-6-yl)-N-cyclohexyl-5-phenylpyrazine-2-carboxamide.
| Compound Name | 3-amino-6-(8-chloroquinolin-6-yl)-N-cyclohexyl-5-phenylpyrazine-2-carboxamide |
|---|---|
| PubChem CID | 137430775 |
| Molecular Formula | C26H24ClN5O |
| Molecular Weight | 457.97 g/mol |
| Exact Mass | 457.17 |
| IUPAC Name | 3-amino-6-(8-chloroquinolin-6-yl)-N-cyclohexyl-5-phenylpyrazine-2-carboxamide |
| SMILES | Nc1nc(-c2ccccc2)c(-c2cc(Cl)c3ncccc3c2)nc1C(=O)NC1CCCCC1 |
| InChI | InChI=1S/C26H24ClN5O/c27-20-15-18(14-17-10-7-13-29-21(17)20)23-22(16-8-3-1-4-9-16)32-25(28)24(31-23)26(33)30-19-11-5-2-6-12-19/h1,3-4,7-10,13-15,19H,2,5-6,11-12H2,(H2,28,32)(H,30,33) |
| InChIKey | ARYJRJNYYBIJOC-UHFFFAOYSA-N |
| XLogP | 5.66 |
| TPSA | 93.79 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 457.97 |
| LogP ≤ 5 | 5.66 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |