C25H23ClN4 — CID 137431688
5-(8-chloroquinolin-6-yl)-3-cyclohexyl-6-phenylpyrazin-2-amine (PubChem CID 137431688) has the molecular formula C25H23ClN4 and a molecular weight of 414.94 g/mol. Its IUPAC name is 5-(8-chloroquinolin-6-yl)-3-cyclohexyl-6-phenylpyrazin-2-amine.
| Compound Name | 5-(8-chloroquinolin-6-yl)-3-cyclohexyl-6-phenylpyrazin-2-amine |
|---|---|
| PubChem CID | 137431688 |
| Molecular Formula | C25H23ClN4 |
| Molecular Weight | 414.94 g/mol |
| Exact Mass | 414.16 |
| IUPAC Name | 5-(8-chloroquinolin-6-yl)-3-cyclohexyl-6-phenylpyrazin-2-amine |
| SMILES | Nc1nc(-c2ccccc2)c(-c2cc(Cl)c3ncccc3c2)nc1C1CCCCC1 |
| InChI | InChI=1S/C25H23ClN4/c26-20-15-19(14-18-12-7-13-28-21(18)20)23-22(16-8-3-1-4-9-16)30-25(27)24(29-23)17-10-5-2-6-11-17/h1,3-4,7-9,12-15,17H,2,5-6,10-11H2,(H2,27,30) |
| InChIKey | FUARHQCGJYTKPZ-UHFFFAOYSA-N |
| XLogP | 6.64 |
| TPSA | 64.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 414.94 |
| LogP ≤ 5 | 6.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |