C23H19ClN4S — CID 137430407
5-(8-chloroquinolin-6-yl)-3-(cyclopropylmethylsulfanyl)-6-phenylpyrazin-2-amine (PubChem CID 137430407) has the molecular formula C23H19ClN4S and a molecular weight of 418.95 g/mol. Its IUPAC name is 5-(8-chloroquinolin-6-yl)-3-(cyclopropylmethylsulfanyl)-6-phenylpyrazin-2-amine.
| Compound Name | 5-(8-chloroquinolin-6-yl)-3-(cyclopropylmethylsulfanyl)-6-phenylpyrazin-2-amine |
|---|---|
| PubChem CID | 137430407 |
| Molecular Formula | C23H19ClN4S |
| Molecular Weight | 418.95 g/mol |
| Exact Mass | 418.10 |
| IUPAC Name | 5-(8-chloroquinolin-6-yl)-3-(cyclopropylmethylsulfanyl)-6-phenylpyrazin-2-amine |
| SMILES | Nc1nc(-c2ccccc2)c(-c2cc(Cl)c3ncccc3c2)nc1SCC1CC1 |
| InChI | InChI=1S/C23H19ClN4S/c24-18-12-17(11-16-7-4-10-26-19(16)18)21-20(15-5-2-1-3-6-15)27-22(25)23(28-21)29-13-14-8-9-14/h1-7,10-12,14H,8-9,13H2,(H2,25,27) |
| InChIKey | OWXIQDMPCHAUBO-UHFFFAOYSA-N |
| XLogP | 6.10 |
| TPSA | 64.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 418.95 |
| LogP ≤ 5 | 6.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |