C24H17ClN6 — CID 137431844
5-(8-chloroquinolin-6-yl)-6-phenyl-3-N-pyridin-3-ylpyrazine-2,3-diamine (PubChem CID 137431844) has the molecular formula C24H17ClN6 and a molecular weight of 424.90 g/mol. Its IUPAC name is 5-(8-chloroquinolin-6-yl)-6-phenyl-3-N-pyridin-3-ylpyrazine-2,3-diamine.
| Compound Name | 5-(8-chloroquinolin-6-yl)-6-phenyl-3-N-pyridin-3-ylpyrazine-2,3-diamine |
|---|---|
| PubChem CID | 137431844 |
| Molecular Formula | C24H17ClN6 |
| Molecular Weight | 424.90 g/mol |
| Exact Mass | 424.12 |
| IUPAC Name | 5-(8-chloroquinolin-6-yl)-6-phenyl-3-N-pyridin-3-ylpyrazine-2,3-diamine |
| SMILES | Nc1nc(-c2ccccc2)c(-c2cc(Cl)c3ncccc3c2)nc1Nc1cccnc1 |
| InChI | InChI=1S/C24H17ClN6/c25-19-13-17(12-16-8-4-11-28-20(16)19)22-21(15-6-2-1-3-7-15)30-23(26)24(31-22)29-18-9-5-10-27-14-18/h1-14H,(H2,26,30)(H,29,31) |
| InChIKey | HSIDZKRYPQVSLX-UHFFFAOYSA-N |
| XLogP | 5.73 |
| TPSA | 89.61 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 424.90 |
| LogP ≤ 5 | 5.73 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |