C22H18ClN5O — CID 137431867
5-(8-chloroquinolin-6-yl)-3-N-(oxetan-3-yl)-6-phenylpyrazine-2,3-diamine (PubChem CID 137431867) has the molecular formula C22H18ClN5O and a molecular weight of 403.87 g/mol. Its IUPAC name is 5-(8-chloroquinolin-6-yl)-3-N-(oxetan-3-yl)-6-phenylpyrazine-2,3-diamine.
| Compound Name | 5-(8-chloroquinolin-6-yl)-3-N-(oxetan-3-yl)-6-phenylpyrazine-2,3-diamine |
|---|---|
| PubChem CID | 137431867 |
| Molecular Formula | C22H18ClN5O |
| Molecular Weight | 403.87 g/mol |
| Exact Mass | 403.12 |
| IUPAC Name | 5-(8-chloroquinolin-6-yl)-3-N-(oxetan-3-yl)-6-phenylpyrazine-2,3-diamine |
| SMILES | Nc1nc(-c2ccccc2)c(-c2cc(Cl)c3ncccc3c2)nc1NC1COC1 |
| InChI | InChI=1S/C22H18ClN5O/c23-17-10-15(9-14-7-4-8-25-18(14)17)20-19(13-5-2-1-3-6-13)27-21(24)22(28-20)26-16-11-29-12-16/h1-10,16H,11-12H2,(H2,24,27)(H,26,28) |
| InChIKey | QXLXMBYYDIMEHV-UHFFFAOYSA-N |
| XLogP | 4.41 |
| TPSA | 85.95 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 403.87 |
| LogP ≤ 5 | 4.41 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |