C25H26ClN7O — CID 137431727
[[3-amino-6-(8-chloroquinolin-6-yl)-5-phenylpyrazin-2-yl]amino]-[(1-methylpyrrolidin-3-yl)amino]methanol (PubChem CID 137431727) has the molecular formula C25H26ClN7O and a molecular weight of 475.98 g/mol. Its IUPAC name is [[3-amino-6-(8-chloroquinolin-6-yl)-5-phenylpyrazin-2-yl]amino]-[(1-methylpyrrolidin-3-yl)amino]methanol.
| Compound Name | [[3-amino-6-(8-chloroquinolin-6-yl)-5-phenylpyrazin-2-yl]amino]-[(1-methylpyrrolidin-3-yl)amino]methanol |
|---|---|
| PubChem CID | 137431727 |
| Molecular Formula | C25H26ClN7O |
| Molecular Weight | 475.98 g/mol |
| Exact Mass | 475.19 |
| IUPAC Name | [[3-amino-6-(8-chloroquinolin-6-yl)-5-phenylpyrazin-2-yl]amino]-[(1-methylpyrrolidin-3-yl)amino]methanol |
| SMILES | CN1CCC(NC(O)Nc2nc(-c3cc(Cl)c4ncccc4c3)c(-c3ccccc3)nc2N)C1 |
| InChI | InChI=1S/C25H26ClN7O/c1-33-11-9-18(14-33)29-25(34)32-24-23(27)30-21(15-6-3-2-4-7-15)22(31-24)17-12-16-8-5-10-28-20(16)19(26)13-17/h2-8,10,12-13,18,25,29,34H,9,11,14H2,1H3,(H2,27,30)(H,31,32) |
| InChIKey | QXMFJKYWDJMTID-UHFFFAOYSA-N |
| XLogP | 3.58 |
| TPSA | 112.22 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 475.98 |
| LogP ≤ 5 | 3.58 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|