C22H18ClN5O — CID 137430245
1-[3-amino-6-(8-chloroquinolin-6-yl)-5-phenylpyrazin-2-yl]azetidin-3-ol (PubChem CID 137430245) has the molecular formula C22H18ClN5O and a molecular weight of 403.87 g/mol. Its IUPAC name is 1-[3-amino-6-(8-chloroquinolin-6-yl)-5-phenylpyrazin-2-yl]azetidin-3-ol.
| Compound Name | 1-[3-amino-6-(8-chloroquinolin-6-yl)-5-phenylpyrazin-2-yl]azetidin-3-ol |
|---|---|
| PubChem CID | 137430245 |
| Molecular Formula | C22H18ClN5O |
| Molecular Weight | 403.87 g/mol |
| Exact Mass | 403.12 |
| IUPAC Name | 1-[3-amino-6-(8-chloroquinolin-6-yl)-5-phenylpyrazin-2-yl]azetidin-3-ol |
| SMILES | Nc1nc(-c2ccccc2)c(-c2cc(Cl)c3ncccc3c2)nc1N1CC(O)C1 |
| InChI | InChI=1S/C22H18ClN5O/c23-17-10-15(9-14-7-4-8-25-18(14)17)20-19(13-5-2-1-3-6-13)26-21(24)22(27-20)28-11-16(29)12-28/h1-10,16,29H,11-12H2,(H2,24,26) |
| InChIKey | FLYYGDNIWYLLFE-UHFFFAOYSA-N |
| XLogP | 3.78 |
| TPSA | 88.16 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 403.87 |
| LogP ≤ 5 | 3.78 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |