C24H19ClN4O2 — CID 137431024
cyclobutyl 3-amino-6-(8-chloroquinolin-6-yl)-5-phenylpyrazine-2-carboxylate (PubChem CID 137431024) has the molecular formula C24H19ClN4O2 and a molecular weight of 430.90 g/mol. Its IUPAC name is cyclobutyl 3-amino-6-(8-chloroquinolin-6-yl)-5-phenylpyrazine-2-carboxylate.
| Compound Name | cyclobutyl 3-amino-6-(8-chloroquinolin-6-yl)-5-phenylpyrazine-2-carboxylate |
|---|---|
| PubChem CID | 137431024 |
| Molecular Formula | C24H19ClN4O2 |
| Molecular Weight | 430.90 g/mol |
| Exact Mass | 430.12 |
| IUPAC Name | cyclobutyl 3-amino-6-(8-chloroquinolin-6-yl)-5-phenylpyrazine-2-carboxylate |
| SMILES | Nc1nc(-c2ccccc2)c(-c2cc(Cl)c3ncccc3c2)nc1C(=O)OC1CCC1 |
| InChI | InChI=1S/C24H19ClN4O2/c25-18-13-16(12-15-8-5-11-27-19(15)18)21-20(14-6-2-1-3-7-14)29-23(26)22(28-21)24(30)31-17-9-4-10-17/h1-3,5-8,11-13,17H,4,9-10H2,(H2,26,29) |
| InChIKey | FIBLCDQWLFNFJZ-UHFFFAOYSA-N |
| XLogP | 5.30 |
| TPSA | 90.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 430.90 |
| LogP ≤ 5 | 5.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |