C26H23ClN4O — CID 137430795
[3-amino-6-(8-chloroquinolin-6-yl)-5-phenylpyrazin-2-yl]-cyclohexylmethanone (PubChem CID 137430795) has the molecular formula C26H23ClN4O and a molecular weight of 442.95 g/mol. Its IUPAC name is [3-amino-6-(8-chloroquinolin-6-yl)-5-phenylpyrazin-2-yl]-cyclohexylmethanone.
| Compound Name | [3-amino-6-(8-chloroquinolin-6-yl)-5-phenylpyrazin-2-yl]-cyclohexylmethanone |
|---|---|
| PubChem CID | 137430795 |
| Molecular Formula | C26H23ClN4O |
| Molecular Weight | 442.95 g/mol |
| Exact Mass | 442.16 |
| IUPAC Name | [3-amino-6-(8-chloroquinolin-6-yl)-5-phenylpyrazin-2-yl]-cyclohexylmethanone |
| SMILES | Nc1nc(-c2ccccc2)c(-c2cc(Cl)c3ncccc3c2)nc1C(=O)C1CCCCC1 |
| InChI | InChI=1S/C26H23ClN4O/c27-20-15-19(14-18-12-7-13-29-21(18)20)23-22(16-8-3-1-4-9-16)31-26(28)24(30-23)25(32)17-10-5-2-6-11-17/h1,3-4,7-9,12-15,17H,2,5-6,10-11H2,(H2,28,31) |
| InChIKey | JKWDBYUHCZEXBE-UHFFFAOYSA-N |
| XLogP | 6.36 |
| TPSA | 81.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 442.95 |
| LogP ≤ 5 | 6.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |