C26H27N5O — CID 154604645
3-[(4-aminocyclohexyl)methoxy]-6-phenyl-5-quinolin-6-ylpyrazin-2-amine (PubChem CID 154604645) has the molecular formula C26H27N5O and a molecular weight of 425.54 g/mol. Its IUPAC name is 3-[(4-aminocyclohexyl)methoxy]-6-phenyl-5-quinolin-6-ylpyrazin-2-amine.
| Compound Name | 3-[(4-aminocyclohexyl)methoxy]-6-phenyl-5-quinolin-6-ylpyrazin-2-amine |
|---|---|
| PubChem CID | 154604645 |
| Molecular Formula | C26H27N5O |
| Molecular Weight | 425.54 g/mol |
| Exact Mass | 425.22 |
| IUPAC Name | 3-[(4-aminocyclohexyl)methoxy]-6-phenyl-5-quinolin-6-ylpyrazin-2-amine |
| SMILES | Nc1nc(-c2ccccc2)c(-c2ccc3ncccc3c2)nc1OCC1CCC(N)CC1 |
| InChI | InChI=1S/C26H27N5O/c27-21-11-8-17(9-12-21)16-32-26-25(28)30-23(18-5-2-1-3-6-18)24(31-26)20-10-13-22-19(15-20)7-4-14-29-22/h1-7,10,13-15,17,21H,8-9,11-12,16,27H2,(H2,28,30) |
| InChIKey | YQCOREMEBPSCRY-UHFFFAOYSA-N |
| XLogP | 4.84 |
| TPSA | 99.94 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 425.54 |
| LogP ≤ 5 | 4.84 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |