C21H18N5+ — CID 157131092
3-cyclopropyl-6-pyridin-1-ium-1-yl-5-quinolin-6-ylpyrazin-2-amine (PubChem CID 157131092) has the molecular formula C21H18N5+ and a molecular weight of 340.41 g/mol. Its IUPAC name is 3-cyclopropyl-6-pyridin-1-ium-1-yl-5-quinolin-6-ylpyrazin-2-amine.
| Compound Name | 3-cyclopropyl-6-pyridin-1-ium-1-yl-5-quinolin-6-ylpyrazin-2-amine |
|---|---|
| PubChem CID | 157131092 |
| Molecular Formula | C21H18N5+ |
| Molecular Weight | 340.41 g/mol |
| Exact Mass | 340.16 |
| IUPAC Name | 3-cyclopropyl-6-pyridin-1-ium-1-yl-5-quinolin-6-ylpyrazin-2-amine |
| SMILES | Nc1nc(-[n+]2ccccc2)c(-c2ccc3ncccc3c2)nc1C1CC1 |
| InChI | InChI=1S/C21H18N5/c22-20-18(14-6-7-14)24-19(21(25-20)26-11-2-1-3-12-26)16-8-9-17-15(13-16)5-4-10-23-17/h1-5,8-14H,6-7H2,(H2,22,25)/q+1 |
| InChIKey | AUXFGLBDZIAGHZ-UHFFFAOYSA-N |
| XLogP | 3.43 |
| TPSA | 68.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 340.41 |
| LogP ≤ 5 | 3.43 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|