C22H14FN5 — CID 146801526
7-(4-fluorophenyl)-8-quinolin-6-ylpyrido[3,4-b]pyrazin-5-amine (PubChem CID 146801526) has the molecular formula C22H14FN5 and a molecular weight of 367.39 g/mol. Its IUPAC name is 7-(4-fluorophenyl)-8-quinolin-6-ylpyrido[3,4-b]pyrazin-5-amine.
| Compound Name | 7-(4-fluorophenyl)-8-quinolin-6-ylpyrido[3,4-b]pyrazin-5-amine |
|---|---|
| PubChem CID | 146801526 |
| Molecular Formula | C22H14FN5 |
| Molecular Weight | 367.39 g/mol |
| Exact Mass | 367.12 |
| IUPAC Name | 7-(4-fluorophenyl)-8-quinolin-6-ylpyrido[3,4-b]pyrazin-5-amine |
| SMILES | Nc1nc(-c2ccc(F)cc2)c(-c2ccc3ncccc3c2)c2nccnc12 |
| InChI | InChI=1S/C22H14FN5/c23-16-6-3-13(4-7-16)19-18(20-21(22(24)28-19)27-11-10-26-20)15-5-8-17-14(12-15)2-1-9-25-17/h1-12H,(H2,24,28) |
| InChIKey | RXZQVVWKEKZJFB-UHFFFAOYSA-N |
| XLogP | 4.63 |
| TPSA | 77.58 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 367.39 |
| LogP ≤ 5 | 4.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |