C14H9BrFN3 — CID 154608543
5-bromo-6-(4-fluorophenyl)-1,7-naphthyridin-8-amine (PubChem CID 154608543) has the molecular formula C14H9BrFN3 and a molecular weight of 318.15 g/mol. Its IUPAC name is 5-bromo-6-(4-fluorophenyl)-1,7-naphthyridin-8-amine.
| Compound Name | 5-bromo-6-(4-fluorophenyl)-1,7-naphthyridin-8-amine |
|---|---|
| PubChem CID | 154608543 |
| Molecular Formula | C14H9BrFN3 |
| Molecular Weight | 318.15 g/mol |
| Exact Mass | 317.00 |
| IUPAC Name | 5-bromo-6-(4-fluorophenyl)-1,7-naphthyridin-8-amine |
| SMILES | Nc1nc(-c2ccc(F)cc2)c(Br)c2cccnc12 |
| InChI | InChI=1S/C14H9BrFN3/c15-11-10-2-1-7-18-13(10)14(17)19-12(11)8-3-5-9(16)6-4-8/h1-7H,(H2,17,19) |
| InChIKey | CWQFYOBAKUYPSE-UHFFFAOYSA-N |
| XLogP | 3.78 |
| TPSA | 51.80 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 318.15 |
| LogP ≤ 5 | 3.78 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |