C21H13FN6 — CID 152831094
7-(4-fluorophenyl)-8-quinoxalin-6-ylpyrido[3,4-b]pyrazin-5-amine (PubChem CID 152831094) has the molecular formula C21H13FN6 and a molecular weight of 368.38 g/mol. Its IUPAC name is 7-(4-fluorophenyl)-8-quinoxalin-6-ylpyrido[3,4-b]pyrazin-5-amine.
| Compound Name | 7-(4-fluorophenyl)-8-quinoxalin-6-ylpyrido[3,4-b]pyrazin-5-amine |
|---|---|
| PubChem CID | 152831094 |
| Molecular Formula | C21H13FN6 |
| Molecular Weight | 368.38 g/mol |
| Exact Mass | 368.12 |
| IUPAC Name | 7-(4-fluorophenyl)-8-quinoxalin-6-ylpyrido[3,4-b]pyrazin-5-amine |
| SMILES | Nc1nc(-c2ccc(F)cc2)c(-c2ccc3nccnc3c2)c2nccnc12 |
| InChI | InChI=1S/C21H13FN6/c22-14-4-1-12(2-5-14)18-17(19-20(21(23)28-18)27-10-9-26-19)13-3-6-15-16(11-13)25-8-7-24-15/h1-11H,(H2,23,28) |
| InChIKey | SWFLYGYAERCZMO-UHFFFAOYSA-N |
| XLogP | 4.02 |
| TPSA | 90.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 368.38 |
| LogP ≤ 5 | 4.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |