C18H12FN3S — CID 158996331
4-(3-fluorophenyl)-2-methyl-5-quinoxalin-6-yl-1,3-thiazole (PubChem CID 158996331) has the molecular formula C18H12FN3S and a molecular weight of 321.38 g/mol. Its IUPAC name is 4-(3-fluorophenyl)-2-methyl-5-quinoxalin-6-yl-1,3-thiazole.
| Compound Name | 4-(3-fluorophenyl)-2-methyl-5-quinoxalin-6-yl-1,3-thiazole |
|---|---|
| PubChem CID | 158996331 |
| Molecular Formula | C18H12FN3S |
| Molecular Weight | 321.38 g/mol |
| Exact Mass | 321.07 |
| IUPAC Name | 4-(3-fluorophenyl)-2-methyl-5-quinoxalin-6-yl-1,3-thiazole |
| SMILES | Cc1nc(-c2cccc(F)c2)c(-c2ccc3nccnc3c2)s1 |
| InChI | InChI=1S/C18H12FN3S/c1-11-22-17(12-3-2-4-14(19)9-12)18(23-11)13-5-6-15-16(10-13)21-8-7-20-15/h2-10H,1H3 |
| InChIKey | CHXCZUFLQJGVNU-UHFFFAOYSA-N |
| XLogP | 4.87 |
| TPSA | 38.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 321.38 |
| LogP ≤ 5 | 4.87 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |