C17H15NS — CID 139241050
2-methyl-5-(4-methylphenyl)-4-phenyl-1,3-thiazole (PubChem CID 139241050) has the molecular formula C17H15NS and a molecular weight of 265.38 g/mol. Its IUPAC name is 2-methyl-5-(4-methylphenyl)-4-phenyl-1,3-thiazole.
| Compound Name | 2-methyl-5-(4-methylphenyl)-4-phenyl-1,3-thiazole |
|---|---|
| PubChem CID | 139241050 |
| Molecular Formula | C17H15NS |
| Molecular Weight | 265.38 g/mol |
| Exact Mass | 265.09 |
| IUPAC Name | 2-methyl-5-(4-methylphenyl)-4-phenyl-1,3-thiazole |
| SMILES | Cc1ccc(-c2sc(C)nc2-c2ccccc2)cc1 |
| InChI | InChI=1S/C17H15NS/c1-12-8-10-15(11-9-12)17-16(18-13(2)19-17)14-6-4-3-5-7-14/h3-11H,1-2H3 |
| InChIKey | YZSBCAUWONFXKR-UHFFFAOYSA-N |
| XLogP | 5.09 |
| TPSA | 12.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 265.38 |
| LogP ≤ 5 | 5.09 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |