C10H8BrNS — CID 86189921
4-bromo-2-methyl-5-phenyl-1,3-thiazole (PubChem CID 86189921) has the molecular formula C10H8BrNS and a molecular weight of 254.15 g/mol. Its IUPAC name is 4-bromo-2-methyl-5-phenyl-1,3-thiazole.
| Compound Name | 4-bromo-2-methyl-5-phenyl-1,3-thiazole |
|---|---|
| PubChem CID | 86189921 |
| Molecular Formula | C10H8BrNS |
| Molecular Weight | 254.15 g/mol |
| Exact Mass | 252.96 |
| IUPAC Name | 4-bromo-2-methyl-5-phenyl-1,3-thiazole |
| SMILES | Cc1nc(Br)c(-c2ccccc2)s1 |
| InChI | InChI=1S/C10H8BrNS/c1-7-12-10(11)9(13-7)8-5-3-2-4-6-8/h2-6H,1H3 |
| InChIKey | XJQWKBSNAXFBSL-UHFFFAOYSA-N |
| XLogP | 3.88 |
| TPSA | 12.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 254.15 |
| LogP ≤ 5 | 3.88 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |