C17H12BrNO2S — CID 43854679
(2-bromophenyl) 2-methyl-5-phenyl-1,3-thiazole-4-carboxylate (PubChem CID 43854679) has the molecular formula C17H12BrNO2S and a molecular weight of 374.26 g/mol. Its IUPAC name is (2-bromophenyl) 2-methyl-5-phenyl-1,3-thiazole-4-carboxylate.
| Compound Name | (2-bromophenyl) 2-methyl-5-phenyl-1,3-thiazole-4-carboxylate |
|---|---|
| PubChem CID | 43854679 |
| Molecular Formula | C17H12BrNO2S |
| Molecular Weight | 374.26 g/mol |
| Exact Mass | 372.98 |
| IUPAC Name | (2-bromophenyl) 2-methyl-5-phenyl-1,3-thiazole-4-carboxylate |
| SMILES | Cc1nc(C(=O)Oc2ccccc2Br)c(-c2ccccc2)s1 |
| InChI | InChI=1S/C17H12BrNO2S/c1-11-19-15(16(22-11)12-7-3-2-4-8-12)17(20)21-14-10-6-5-9-13(14)18/h2-10H,1H3 |
| InChIKey | MKVLUROXWBXXDB-UHFFFAOYSA-N |
| XLogP | 5.10 |
| TPSA | 39.19 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 374.26 |
| LogP ≤ 5 | 5.10 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|