C17H13BrS — CID 89479588
3-bromo-4-methyl-2,5-diphenylthiophene (PubChem CID 89479588) has the molecular formula C17H13BrS and a molecular weight of 329.26 g/mol. Its IUPAC name is 3-bromo-4-methyl-2,5-diphenylthiophene.
| Compound Name | 3-bromo-4-methyl-2,5-diphenylthiophene |
|---|---|
| PubChem CID | 89479588 |
| Molecular Formula | C17H13BrS |
| Molecular Weight | 329.26 g/mol |
| Exact Mass | 327.99 |
| IUPAC Name | 3-bromo-4-methyl-2,5-diphenylthiophene |
| SMILES | Cc1c(-c2ccccc2)sc(-c2ccccc2)c1Br |
| InChI | InChI=1S/C17H13BrS/c1-12-15(18)17(14-10-6-3-7-11-14)19-16(12)13-8-4-2-5-9-13/h2-11H,1H3 |
| InChIKey | WJJHHXYNFWKEBF-UHFFFAOYSA-N |
| XLogP | 6.15 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 329.26 |
| LogP ≤ 5 | 6.15 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |