C32H20S4 — CID 177405834
4,6,10,12-tetraphenyl-2,5,8,11-tetrathiatricyclo[7.3.0.03,7]dodeca-1(12),3,6,9-tetraene (PubChem CID 177405834) has the molecular formula C32H20S4 and a molecular weight of 532.78 g/mol. Its IUPAC name is 4,6,10,12-tetraphenyl-2,5,8,11-tetrathiatricyclo[7.3.0.03,7]dodeca-1(12),3,6,9-tetraene.
| Compound Name | 4,6,10,12-tetraphenyl-2,5,8,11-tetrathiatricyclo[7.3.0.03,7]dodeca-1(12),3,6,9-tetraene |
|---|---|
| PubChem CID | 177405834 |
| Molecular Formula | C32H20S4 |
| Molecular Weight | 532.78 g/mol |
| Exact Mass | 532.04 |
| IUPAC Name | 4,6,10,12-tetraphenyl-2,5,8,11-tetrathiatricyclo[7.3.0.03,7]dodeca-1(12),3,6,9-tetraene |
| SMILES | c1ccc(-c2sc(-c3ccccc3)c3c2Sc2c(-c4ccccc4)sc(-c4ccccc4)c2S3)cc1 |
| InChI | InChI=1S/C32H20S4/c1-5-13-21(14-6-1)25-29-30(26(33-25)22-15-7-2-8-16-22)36-32-28(24-19-11-4-12-20-24)34-27(31(32)35-29)23-17-9-3-10-18-23/h1-20H |
| InChIKey | MJJBYTAGGIFCJM-UHFFFAOYSA-N |
| XLogP | 11.09 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 532.78 |
| LogP ≤ 5 | 11.09 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |