C30H20S3 — CID 13015937
3,4,6,7-tetraphenylthieno[3,2-c]dithiine (PubChem CID 13015937) has the molecular formula C30H20S3 and a molecular weight of 476.69 g/mol. Its IUPAC name is 3,4,6,7-tetraphenylthieno[3,2-c]dithiine.
| Compound Name | 3,4,6,7-tetraphenylthieno[3,2-c]dithiine |
|---|---|
| PubChem CID | 13015937 |
| Molecular Formula | C30H20S3 |
| Molecular Weight | 476.69 g/mol |
| Exact Mass | 476.07 |
| IUPAC Name | 3,4,6,7-tetraphenylthieno[3,2-c]dithiine |
| SMILES | c1ccc(C2=C(c3ccccc3)c3sc(-c4ccccc4)c(-c4ccccc4)c3SS2)cc1 |
| InChI | InChI=1S/C30H20S3/c1-5-13-21(14-6-1)25-27(23-17-9-3-10-18-23)31-29-26(22-15-7-2-8-16-22)28(32-33-30(25)29)24-19-11-4-12-20-24/h1-20H |
| InChIKey | BEXFAALGMWNUKF-UHFFFAOYSA-N |
| XLogP | 9.75 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 476.69 |
| LogP ≤ 5 | 9.75 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'disulphide', 'substructure': 'N/A'}, {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|