C28H17Cl3S — CID 139964410
2,3,5-tris(4-chlorophenyl)-4-phenylthiophene (PubChem CID 139964410) has the molecular formula C28H17Cl3S and a molecular weight of 491.87 g/mol. Its IUPAC name is 2,3,5-tris(4-chlorophenyl)-4-phenylthiophene.
| Compound Name | 2,3,5-tris(4-chlorophenyl)-4-phenylthiophene |
|---|---|
| PubChem CID | 139964410 |
| Molecular Formula | C28H17Cl3S |
| Molecular Weight | 491.87 g/mol |
| Exact Mass | 490.01 |
| IUPAC Name | 2,3,5-tris(4-chlorophenyl)-4-phenylthiophene |
| SMILES | Clc1ccc(-c2sc(-c3ccc(Cl)cc3)c(-c3ccc(Cl)cc3)c2-c2ccccc2)cc1 |
| InChI | InChI=1S/C28H17Cl3S/c29-22-12-6-19(7-13-22)26-25(18-4-2-1-3-5-18)27(20-8-14-23(30)15-9-20)32-28(26)21-10-16-24(31)17-11-21/h1-17H |
| InChIKey | IZJJNSPYMLTCTD-UHFFFAOYSA-N |
| XLogP | 10.38 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 491.87 |
| LogP ≤ 5 | 10.38 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |