C30H24O6S — CID 23188696
carbonic acid;2,3,4,5-tetraphenylthiophene (PubChem CID 23188696) has the molecular formula C30H24O6S and a molecular weight of 512.58 g/mol. Its IUPAC name is carbonic acid;2,3,4,5-tetraphenylthiophene.
| Compound Name | carbonic acid;2,3,4,5-tetraphenylthiophene |
|---|---|
| PubChem CID | 23188696 |
| Molecular Formula | C30H24O6S |
| Molecular Weight | 512.58 g/mol |
| Exact Mass | 512.13 |
| IUPAC Name | carbonic acid;2,3,4,5-tetraphenylthiophene |
| SMILES | O=C(O)O.O=C(O)O.c1ccc(-c2sc(-c3ccccc3)c(-c3ccccc3)c2-c2ccccc2)cc1 |
| InChI | InChI=1S/C28H20S.2CH2O3/c1-5-13-21(14-6-1)25-26(22-15-7-2-8-16-22)28(24-19-11-4-12-20-24)29-27(25)23-17-9-3-10-18-23;2*2-1(3)4/h1-20H;2*(H2,2,3,4) |
| InChIKey | ZFWUSFBSKUYLIR-UHFFFAOYSA-N |
| XLogP | 8.86 |
| TPSA | 115.06 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 512.58 |
| LogP ≤ 5 | 8.86 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 3 |